C29H46O6 — CID 99573719
methyl (4S)-4-[(5R,8S,9S,10S,11R,12R,13R,14S,17R)-11,12-diacetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 99573719) has the molecular formula C29H46O6 and a molecular weight of 490.68 g/mol. Its IUPAC name is methyl (4S)-4-[(5R,8S,9S,10S,11R,12R,13R,14S,17R)-11,12-diacetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4S)-4-[(5R,8S,9S,10S,11R,12R,13R,14S,17R)-11,12-diacetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 99573719 |
| Molecular Formula | C29H46O6 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | methyl (4S)-4-[(5R,8S,9S,10S,11R,12R,13R,14S,17R)-11,12-diacetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4CCCC[C@]4(C)[C@H]3[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@]12C |
| InChI | InChI=1S/C29H46O6/c1-17(10-15-24(32)33-6)22-13-14-23-21-12-11-20-9-7-8-16-28(20,4)25(21)26(34-18(2)30)27(29(22,23)5)35-19(3)31/h17,20-23,25-27H,7-16H2,1-6H3/t17-,20+,21-,22+,23-,25+,26+,27-,28-,29+/m0/s1 |
| InChIKey | IQSIHGTXMZKONQ-UBJQIKGNSA-N |
| XLogP | 5.71 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|