C27H42Br2O4 — CID 125031573
methyl (4S)-4-[(3R,5R,8S,9R,10S,11S,12S,13S,14R,17S)-3-acetyloxy-11,12-dibromo-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 125031573) has the molecular formula C27H42Br2O4 and a molecular weight of 590.44 g/mol. Its IUPAC name is methyl (4S)-4-[(3R,5R,8S,9R,10S,11S,12S,13S,14R,17S)-3-acetyloxy-11,12-dibromo-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4S)-4-[(3R,5R,8S,9R,10S,11S,12S,13S,14R,17S)-3-acetyloxy-11,12-dibromo-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 125031573 |
| Molecular Formula | C27H42Br2O4 |
| Molecular Weight | 590.44 g/mol |
| Exact Mass | 588.14 |
| IUPAC Name | methyl (4S)-4-[(3R,5R,8S,9R,10S,11S,12S,13S,14R,17S)-3-acetyloxy-11,12-dibromo-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@H](C)[C@@H]1CC[C@@H]2[C@@H]3CC[C@@H]4C[C@H](OC(C)=O)CC[C@]4(C)[C@@H]3[C@H](Br)[C@@H](Br)[C@]21C |
| InChI | InChI=1S/C27H42Br2O4/c1-15(6-11-22(31)32-5)20-9-10-21-19-8-7-17-14-18(33-16(2)30)12-13-26(17,3)23(19)24(28)25(29)27(20,21)4/h15,17-21,23-25H,6-14H2,1-5H3/t15-,17+,18+,19-,20-,21+,23-,24-,25+,26-,27-/m0/s1 |
| InChIKey | PHKGSDJTFGIGIZ-PCUHPMCISA-N |
| XLogP | 6.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.44 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|