C33H53NO4 — CID 145089785
[(3R,6R,7R,8S,9S,14S)-7-acetyloxy-17-[(2R)-7-cyanoheptan-2-yl]-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 145089785) has the molecular formula C33H53NO4 and a molecular weight of 527.79 g/mol. Its IUPAC name is [(3R,6R,7R,8S,9S,14S)-7-acetyloxy-17-[(2R)-7-cyanoheptan-2-yl]-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3R,6R,7R,8S,9S,14S)-7-acetyloxy-17-[(2R)-7-cyanoheptan-2-yl]-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 145089785 |
| Molecular Formula | C33H53NO4 |
| Molecular Weight | 527.79 g/mol |
| Exact Mass | 527.40 |
| IUPAC Name | [(3R,6R,7R,8S,9S,14S)-7-acetyloxy-17-[(2R)-7-cyanoheptan-2-yl]-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC[C@@H]1C2C[C@H](OC(C)=O)CCC2(C)[C@H]2CCC3(C)C([C@H](C)CCCCCC#N)CC[C@H]3[C@@H]2[C@@H]1OC(C)=O |
| InChI | InChI=1S/C33H53NO4/c1-7-25-29-20-24(37-22(3)35)15-17-33(29,6)28-16-18-32(5)26(21(2)12-10-8-9-11-19-34)13-14-27(32)30(28)31(25)38-23(4)36/h21,24-31H,7-18,20H2,1-6H3/t21-,24-,25-,26?,27+,28+,29?,30+,31-,32?,33?/m1/s1 |
| InChIKey | WNTIBJXVUYVRGP-GWXGIROISA-N |
| XLogP | 7.86 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.79 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|