C29H49NO2 — CID 158225475
(4R)-4-[(3R,5S,6R,10S,13R,17R)-6-ethyl-7-(methoxymethoxy)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanenitrile (PubChem CID 158225475) has the molecular formula C29H49NO2 and a molecular weight of 443.72 g/mol. Its IUPAC name is (4R)-4-[(3R,5S,6R,10S,13R,17R)-6-ethyl-7-(methoxymethoxy)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanenitrile.
| Compound Name | (4R)-4-[(3R,5S,6R,10S,13R,17R)-6-ethyl-7-(methoxymethoxy)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanenitrile |
|---|---|
| PubChem CID | 158225475 |
| Molecular Formula | C29H49NO2 |
| Molecular Weight | 443.72 g/mol |
| Exact Mass | 443.38 |
| IUPAC Name | (4R)-4-[(3R,5S,6R,10S,13R,17R)-6-ethyl-7-(methoxymethoxy)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanenitrile |
| SMILES | CC[C@H]1C(OCOC)C2C3CC[C@H]([C@H](C)CCC#N)[C@@]3(C)CCC2[C@@]2(C)CC[C@@H](C)C[C@@H]12 |
| InChI | InChI=1S/C29H49NO2/c1-7-21-25-17-19(2)12-14-29(25,5)24-13-15-28(4)22(20(3)9-8-16-30)10-11-23(28)26(24)27(21)32-18-31-6/h19-27H,7-15,17-18H2,1-6H3/t19-,20-,21-,22-,23?,24?,25+,26?,27?,28-,29-/m1/s1 |
| InChIKey | IYJFBHCSECGPHK-DCHWABJYSA-N |
| XLogP | 7.46 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.72 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|