C29H54O2Si — CID 158297934
(3R)-3-[(3R,5S,6R,7R,8S,9S,10S,13R,14S,17R)-6-ethyl-3,10,13-trimethyl-7-trimethylsilyloxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butan-1-ol (PubChem CID 158297934) has the molecular formula C29H54O2Si and a molecular weight of 462.84 g/mol. Its IUPAC name is (3R)-3-[(3R,5S,6R,7R,8S,9S,10S,13R,14S,17R)-6-ethyl-3,10,13-trimethyl-7-trimethylsilyloxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butan-1-ol.
| Compound Name | (3R)-3-[(3R,5S,6R,7R,8S,9S,10S,13R,14S,17R)-6-ethyl-3,10,13-trimethyl-7-trimethylsilyloxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butan-1-ol |
|---|---|
| PubChem CID | 158297934 |
| Molecular Formula | C29H54O2Si |
| Molecular Weight | 462.84 g/mol |
| Exact Mass | 462.39 |
| IUPAC Name | (3R)-3-[(3R,5S,6R,7R,8S,9S,10S,13R,14S,17R)-6-ethyl-3,10,13-trimethyl-7-trimethylsilyloxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]butan-1-ol |
| SMILES | CC[C@H]1[C@@H](O[Si](C)(C)C)[C@@H]2[C@H](CC[C@]3(C)[C@@H]([C@H](C)CCO)CC[C@@H]23)[C@@]2(C)CC[C@@H](C)C[C@@H]12 |
| InChI | InChI=1S/C29H54O2Si/c1-9-21-25-18-19(2)12-15-29(25,5)24-13-16-28(4)22(20(3)14-17-30)10-11-23(28)26(24)27(21)31-32(6,7)8/h19-27,30H,9-18H2,1-8H3/t19-,20-,21-,22-,23+,24+,25+,26+,27-,28-,29-/m1/s1 |
| InChIKey | GHCUVGZKBVMBPE-JRXJEWNISA-N |
| XLogP | 7.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.84 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|