C29H45IO5 — CID 129013250
methyl (3R)-3-[(3R,5S,6R,7R,10S,12R,13R,17R)-7-acetyloxy-6-ethyl-12-iodo-3,10,13-trimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]butanoate (PubChem CID 129013250) has the molecular formula C29H45IO5 and a molecular weight of 600.58 g/mol. Its IUPAC name is methyl (3R)-3-[(3R,5S,6R,7R,10S,12R,13R,17R)-7-acetyloxy-6-ethyl-12-iodo-3,10,13-trimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]butanoate.
| Compound Name | methyl (3R)-3-[(3R,5S,6R,7R,10S,12R,13R,17R)-7-acetyloxy-6-ethyl-12-iodo-3,10,13-trimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]butanoate |
|---|---|
| PubChem CID | 129013250 |
| Molecular Formula | C29H45IO5 |
| Molecular Weight | 600.58 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | methyl (3R)-3-[(3R,5S,6R,7R,10S,12R,13R,17R)-7-acetyloxy-6-ethyl-12-iodo-3,10,13-trimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]butanoate |
| SMILES | CC[C@H]1C(OC(C)=O)C2C3CC[C@H]([C@H](C)CC(=O)OC)[C@@]3(C)[C@@H](I)C(=O)C2[C@@]2(C)CC[C@@H](C)C[C@@H]12 |
| InChI | InChI=1S/C29H45IO5/c1-8-18-21-13-15(2)11-12-28(21,5)24-23(26(18)35-17(4)31)20-10-9-19(16(3)14-22(32)34-7)29(20,6)27(30)25(24)33/h15-16,18-21,23-24,26-27H,8-14H2,1-7H3/t15-,16-,18-,19-,20?,21+,23?,24?,26?,27+,28+,29-/m1/s1 |
| InChIKey | OJZIJRGQKZTLHG-GKWLRRCNSA-N |
| XLogP | 6.25 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.58 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|