C29H43BrO6 — CID 164744305
methyl (4R)-4-[(3R,5S,6R,10S,12R,13R,17R)-3-acetyloxy-12-bromo-6-ethyl-10,13-dimethyl-7,11-dioxo-2,3,4,5,6,8,9,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 164744305) has the molecular formula C29H43BrO6 and a molecular weight of 567.56 g/mol. Its IUPAC name is methyl (4R)-4-[(3R,5S,6R,10S,12R,13R,17R)-3-acetyloxy-12-bromo-6-ethyl-10,13-dimethyl-7,11-dioxo-2,3,4,5,6,8,9,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(3R,5S,6R,10S,12R,13R,17R)-3-acetyloxy-12-bromo-6-ethyl-10,13-dimethyl-7,11-dioxo-2,3,4,5,6,8,9,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 164744305 |
| Molecular Formula | C29H43BrO6 |
| Molecular Weight | 567.56 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | methyl (4R)-4-[(3R,5S,6R,10S,12R,13R,17R)-3-acetyloxy-12-bromo-6-ethyl-10,13-dimethyl-7,11-dioxo-2,3,4,5,6,8,9,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | CC[C@H]1C(=O)C2C3CC[C@H]([C@H](C)CCC(=O)OC)[C@@]3(C)[C@@H](Br)C(=O)C2[C@@]2(C)CC[C@@H](OC(C)=O)C[C@@H]12 |
| InChI | InChI=1S/C29H43BrO6/c1-7-18-21-14-17(36-16(3)31)12-13-28(21,4)24-23(25(18)33)20-10-9-19(15(2)8-11-22(32)35-6)29(20,5)27(30)26(24)34/h15,17-21,23-24,27H,7-14H2,1-6H3/t15-,17-,18-,19-,20?,21+,23?,24?,27+,28+,29-/m1/s1 |
| InChIKey | LBCACTQKVCHVSL-WHKWLNTISA-N |
| XLogP | 5.53 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.56 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|