C28H43BrO5 — CID 166948675
methyl (4R)-4-[(3R,5R,6R,8S,9S,10S,13R,14S,17R)-3-acetyloxy-6-bromo-9,10,13-trimethyl-7-oxo-2,3,4,5,6,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 166948675) has the molecular formula C28H43BrO5 and a molecular weight of 539.55 g/mol. Its IUPAC name is methyl (4R)-4-[(3R,5R,6R,8S,9S,10S,13R,14S,17R)-3-acetyloxy-6-bromo-9,10,13-trimethyl-7-oxo-2,3,4,5,6,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(3R,5R,6R,8S,9S,10S,13R,14S,17R)-3-acetyloxy-6-bromo-9,10,13-trimethyl-7-oxo-2,3,4,5,6,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 166948675 |
| Molecular Formula | C28H43BrO5 |
| Molecular Weight | 539.55 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | methyl (4R)-4-[(3R,5R,6R,8S,9S,10S,13R,14S,17R)-3-acetyloxy-6-bromo-9,10,13-trimethyl-7-oxo-2,3,4,5,6,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C(=O)[C@H](Br)[C@@H]4C[C@H](OC(C)=O)CC[C@]4(C)[C@@]3(C)CC[C@]12C |
| InChI | InChI=1S/C28H43BrO5/c1-16(7-10-22(31)33-6)19-8-9-20-23-25(32)24(29)21-15-18(34-17(2)30)11-12-27(21,4)28(23,5)14-13-26(19,20)3/h16,18-21,23-24H,7-15H2,1-6H3/t16-,18-,19-,20+,21+,23-,24-,26-,27+,28+/m1/s1 |
| InChIKey | FSZPTDMITWSABK-CXZWZHHRSA-N |
| XLogP | 6.11 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.55 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|