C10H14N2O2 — CID 129452367
2-cyclopropyl-1-(3-methoxy-1-methylpyrazol-4-yl)ethanone (PubChem CID 129452367) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-cyclopropyl-1-(3-methoxy-1-methylpyrazol-4-yl)ethanone.
| Compound Name | 2-cyclopropyl-1-(3-methoxy-1-methylpyrazol-4-yl)ethanone |
|---|---|
| PubChem CID | 129452367 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2-cyclopropyl-1-(3-methoxy-1-methylpyrazol-4-yl)ethanone |
| SMILES | COc1nn(C)cc1C(=O)CC1CC1 |
| InChI | InChI=1S/C10H14N2O2/c1-12-6-8(10(11-12)14-2)9(13)5-7-3-4-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | WYLQHALIBBTFGI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |