C13H17NO3 — CID 105092072
1-(2-methoxy-3-pyridinyl)-2-(oxan-4-yl)ethanone (PubChem CID 105092072) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 1-(2-methoxy-3-pyridinyl)-2-(oxan-4-yl)ethanone.
| Compound Name | 1-(2-methoxy-3-pyridinyl)-2-(oxan-4-yl)ethanone |
|---|---|
| PubChem CID | 105092072 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 1-(2-methoxy-3-pyridinyl)-2-(oxan-4-yl)ethanone |
| SMILES | COc1ncccc1C(=O)CC1CCOCC1 |
| InChI | InChI=1S/C13H17NO3/c1-16-13-11(3-2-6-14-13)12(15)9-10-4-7-17-8-5-10/h2-3,6,10H,4-5,7-9H2,1H3 |
| InChIKey | CUMCXOLXDQZIIR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |