C16H17NO2 — CID 105092025
2-(oxan-4-yl)-1-quinolin-5-ylethanone (PubChem CID 105092025) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-(oxan-4-yl)-1-quinolin-5-ylethanone.
| Compound Name | 2-(oxan-4-yl)-1-quinolin-5-ylethanone |
|---|---|
| PubChem CID | 105092025 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 2-(oxan-4-yl)-1-quinolin-5-ylethanone |
| SMILES | O=C(CC1CCOCC1)c1cccc2ncccc12 |
| InChI | InChI=1S/C16H17NO2/c18-16(11-12-6-9-19-10-7-12)14-3-1-5-15-13(14)4-2-8-17-15/h1-5,8,12H,6-7,9-11H2 |
| InChIKey | XHALOEDGAXPKOY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |