C28H36F3N3O — CID 157447250
2-[4-[2-[(3aS,7aR)-2-(2,2,2-trifluoroethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]ethyl]cyclohexyl]-1-quinolin-5-ylethanone (PubChem CID 157447250) has the molecular formula C28H36F3N3O and a molecular weight of 487.61 g/mol. Its IUPAC name is 2-[4-[2-[(3aS,7aR)-2-(2,2,2-trifluoroethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]ethyl]cyclohexyl]-1-quinolin-5-ylethanone.
| Compound Name | 2-[4-[2-[(3aS,7aR)-2-(2,2,2-trifluoroethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]ethyl]cyclohexyl]-1-quinolin-5-ylethanone |
|---|---|
| PubChem CID | 157447250 |
| Molecular Formula | C28H36F3N3O |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | 2-[4-[2-[(3aS,7aR)-2-(2,2,2-trifluoroethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]ethyl]cyclohexyl]-1-quinolin-5-ylethanone |
| SMILES | O=C(CC1CCC(CCN2CC[C@H]3CN(CC(F)(F)F)C[C@@H]3C2)CC1)c1cccc2ncccc12 |
| InChI | InChI=1S/C28H36F3N3O/c29-28(30,31)19-34-16-22-11-14-33(17-23(22)18-34)13-10-20-6-8-21(9-7-20)15-27(35)25-3-1-5-26-24(25)4-2-12-32-26/h1-5,12,20-23H,6-11,13-19H2/t20?,21?,22-,23-/m0/s1 |
| InChIKey | BSJFQULJAQUQQH-BBITVKMKSA-N |
| XLogP | 5.82 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |