C25H34N4O — CID 138670641
N-[4-[2-[(3aR,7aR)-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,4-c]pyridin-5-yl]ethyl]cyclohexyl]quinoline-5-carboxamide (PubChem CID 138670641) has the molecular formula C25H34N4O and a molecular weight of 406.57 g/mol. Its IUPAC name is N-[4-[2-[(3aR,7aR)-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,4-c]pyridin-5-yl]ethyl]cyclohexyl]quinoline-5-carboxamide.
| Compound Name | N-[4-[2-[(3aR,7aR)-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,4-c]pyridin-5-yl]ethyl]cyclohexyl]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 138670641 |
| Molecular Formula | C25H34N4O |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | N-[4-[2-[(3aR,7aR)-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,4-c]pyridin-5-yl]ethyl]cyclohexyl]quinoline-5-carboxamide |
| SMILES | O=C(NC1CCC(CCN2CC[C@H]3CNC[C@@H]3C2)CC1)c1cccc2ncccc12 |
| InChI | InChI=1S/C25H34N4O/c30-25(23-3-1-5-24-22(23)4-2-12-27-24)28-21-8-6-18(7-9-21)10-13-29-14-11-19-15-26-16-20(19)17-29/h1-5,12,18-21,26H,6-11,13-17H2,(H,28,30)/t18?,19-,20+,21?/m0/s1 |
| InChIKey | KFLFHUYULPHZFT-RKDVLTNBSA-N |
| XLogP | 3.45 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |