C31H38N4O — CID 145451582
N-[4-[2-[(3aS)-2-phenyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]ethyl]cyclohexyl]quinoline-5-carboxamide (PubChem CID 145451582) has the molecular formula C31H38N4O and a molecular weight of 482.67 g/mol. Its IUPAC name is N-[4-[2-[(3aS)-2-phenyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]ethyl]cyclohexyl]quinoline-5-carboxamide.
| Compound Name | N-[4-[2-[(3aS)-2-phenyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]ethyl]cyclohexyl]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 145451582 |
| Molecular Formula | C31H38N4O |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | N-[4-[2-[(3aS)-2-phenyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]ethyl]cyclohexyl]quinoline-5-carboxamide |
| SMILES | O=C(NC1CCC(CCN2CCC3CN(c4ccccc4)C[C@@H]3C2)CC1)c1cccc2ncccc12 |
| InChI | InChI=1S/C31H38N4O/c36-31(29-8-4-10-30-28(29)9-5-17-32-30)33-26-13-11-23(12-14-26)15-18-34-19-16-24-21-35(22-25(24)20-34)27-6-2-1-3-7-27/h1-10,17,23-26H,11-16,18-22H2,(H,33,36)/t23?,24?,25-,26?/m0/s1 |
| InChIKey | XKIOBCRGUACSET-BBJQCEGISA-N |
| XLogP | 5.37 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |