C18H22N2O3S — CID 90610942
2-methoxy-N-(oxan-4-yl)-N-(2-thiophen-2-ylethyl)pyridine-3-carboxamide (PubChem CID 90610942) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is 2-methoxy-N-(oxan-4-yl)-N-(2-thiophen-2-ylethyl)pyridine-3-carboxamide.
| Compound Name | 2-methoxy-N-(oxan-4-yl)-N-(2-thiophen-2-ylethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 90610942 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2-methoxy-N-(oxan-4-yl)-N-(2-thiophen-2-ylethyl)pyridine-3-carboxamide |
| SMILES | COc1ncccc1C(=O)N(CCc1cccs1)C1CCOCC1 |
| InChI | InChI=1S/C18H22N2O3S/c1-22-17-16(5-2-9-19-17)18(21)20(14-7-11-23-12-8-14)10-6-15-4-3-13-24-15/h2-5,9,13-14H,6-8,10-12H2,1H3 |
| InChIKey | XIAYFWUNDDADBN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |