C29H33N3O3 — CID 129453310
[(3S,3aS,7aR)-3-(4-methoxyphenyl)-1-methyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-[2-[(2-methoxyphenyl)methyl]-4-pyridinyl]methanone (PubChem CID 129453310) has the molecular formula C29H33N3O3 and a molecular weight of 471.60 g/mol. Its IUPAC name is [(3S,3aS,7aR)-3-(4-methoxyphenyl)-1-methyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-[2-[(2-methoxyphenyl)methyl]-4-pyridinyl]methanone.
| Compound Name | [(3S,3aS,7aR)-3-(4-methoxyphenyl)-1-methyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-[2-[(2-methoxyphenyl)methyl]-4-pyridinyl]methanone |
|---|---|
| PubChem CID | 129453310 |
| Molecular Formula | C29H33N3O3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | [(3S,3aS,7aR)-3-(4-methoxyphenyl)-1-methyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-[2-[(2-methoxyphenyl)methyl]-4-pyridinyl]methanone |
| SMILES | COc1ccc([C@H]2CN(C)[C@@H]3CCN(C(=O)c4ccnc(Cc5ccccc5OC)c4)C[C@H]23)cc1 |
| InChI | InChI=1S/C29H33N3O3/c1-31-18-25(20-8-10-24(34-2)11-9-20)26-19-32(15-13-27(26)31)29(33)22-12-14-30-23(17-22)16-21-6-4-5-7-28(21)35-3/h4-12,14,17,25-27H,13,15-16,18-19H2,1-3H3/t25-,26-,27-/m1/s1 |
| InChIKey | AGOYFHVMKUIIOW-ZONZVBGPSA-N |
| XLogP | 4.25 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |