C28H33N3O — CID 129455813
4-[(2-phenylphenyl)methyl]-N-propyl-1-(pyridin-2-ylmethyl)piperidine-4-carboxamide (PubChem CID 129455813) has the molecular formula C28H33N3O and a molecular weight of 427.59 g/mol. Its IUPAC name is 4-[(2-phenylphenyl)methyl]-N-propyl-1-(pyridin-2-ylmethyl)piperidine-4-carboxamide.
| Compound Name | 4-[(2-phenylphenyl)methyl]-N-propyl-1-(pyridin-2-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 129455813 |
| Molecular Formula | C28H33N3O |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | 4-[(2-phenylphenyl)methyl]-N-propyl-1-(pyridin-2-ylmethyl)piperidine-4-carboxamide |
| SMILES | CCCNC(=O)C1(Cc2ccccc2-c2ccccc2)CCN(Cc2ccccn2)CC1 |
| InChI | InChI=1S/C28H33N3O/c1-2-17-30-27(32)28(15-19-31(20-16-28)22-25-13-8-9-18-29-25)21-24-12-6-7-14-26(24)23-10-4-3-5-11-23/h3-14,18H,2,15-17,19-22H2,1H3,(H,30,32) |
| InChIKey | JONVHKCNXVUYBP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |