C23H37N3O4 — CID 129455927
N-[1-[[(3R)-1-[[4-(2-ethoxyethoxy)phenyl]methyl]-3-hydroxypyrrolidin-3-yl]methyl]piperidin-4-yl]acetamide (PubChem CID 129455927) has the molecular formula C23H37N3O4 and a molecular weight of 419.57 g/mol. Its IUPAC name is N-[1-[[(3R)-1-[[4-(2-ethoxyethoxy)phenyl]methyl]-3-hydroxypyrrolidin-3-yl]methyl]piperidin-4-yl]acetamide.
| Compound Name | N-[1-[[(3R)-1-[[4-(2-ethoxyethoxy)phenyl]methyl]-3-hydroxypyrrolidin-3-yl]methyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 129455927 |
| Molecular Formula | C23H37N3O4 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | N-[1-[[(3R)-1-[[4-(2-ethoxyethoxy)phenyl]methyl]-3-hydroxypyrrolidin-3-yl]methyl]piperidin-4-yl]acetamide |
| SMILES | CCOCCOc1ccc(CN2CC[C@@](O)(CN3CCC(NC(C)=O)CC3)C2)cc1 |
| InChI | InChI=1S/C23H37N3O4/c1-3-29-14-15-30-22-6-4-20(5-7-22)16-26-13-10-23(28,18-26)17-25-11-8-21(9-12-25)24-19(2)27/h4-7,21,28H,3,8-18H2,1-2H3,(H,24,27)/t23-/m1/s1 |
| InChIKey | JYYKFJQIMRTWGO-HSZRJFAPSA-N |
| XLogP | 1.64 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|