C27H30N4O3 — CID 129457217
(2-methyl-3-morpholin-4-ylphenyl)-[(3S)-3-(6-phenoxypyrazin-2-yl)piperidin-1-yl]methanone (PubChem CID 129457217) has the molecular formula C27H30N4O3 and a molecular weight of 458.56 g/mol. Its IUPAC name is (2-methyl-3-morpholin-4-ylphenyl)-[(3S)-3-(6-phenoxypyrazin-2-yl)piperidin-1-yl]methanone.
| Compound Name | (2-methyl-3-morpholin-4-ylphenyl)-[(3S)-3-(6-phenoxypyrazin-2-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 129457217 |
| Molecular Formula | C27H30N4O3 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | (2-methyl-3-morpholin-4-ylphenyl)-[(3S)-3-(6-phenoxypyrazin-2-yl)piperidin-1-yl]methanone |
| SMILES | Cc1c(C(=O)N2CCC[C@H](c3cncc(Oc4ccccc4)n3)C2)cccc1N1CCOCC1 |
| InChI | InChI=1S/C27H30N4O3/c1-20-23(10-5-11-25(20)30-13-15-33-16-14-30)27(32)31-12-6-7-21(19-31)24-17-28-18-26(29-24)34-22-8-3-2-4-9-22/h2-5,8-11,17-18,21H,6-7,12-16,19H2,1H3/t21-/m0/s1 |
| InChIKey | OOQARHRMZQNROB-NRFANRHFSA-N |
| XLogP | 4.43 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |