C29H30N2O4 — CID 129457366
4-butoxy-3-[5-(2-methoxyphenyl)-1-(2-phenylethyl)pyrazol-3-yl]benzoic acid (PubChem CID 129457366) has the molecular formula C29H30N2O4 and a molecular weight of 470.57 g/mol. Its IUPAC name is 4-butoxy-3-[5-(2-methoxyphenyl)-1-(2-phenylethyl)pyrazol-3-yl]benzoic acid.
| Compound Name | 4-butoxy-3-[5-(2-methoxyphenyl)-1-(2-phenylethyl)pyrazol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 129457366 |
| Molecular Formula | C29H30N2O4 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 4-butoxy-3-[5-(2-methoxyphenyl)-1-(2-phenylethyl)pyrazol-3-yl]benzoic acid |
| SMILES | CCCCOc1ccc(C(=O)O)cc1-c1cc(-c2ccccc2OC)n(CCc2ccccc2)n1 |
| InChI | InChI=1S/C29H30N2O4/c1-3-4-18-35-28-15-14-22(29(32)33)19-24(28)25-20-26(23-12-8-9-13-27(23)34-2)31(30-25)17-16-21-10-6-5-7-11-21/h5-15,19-20H,3-4,16-18H2,1-2H3,(H,32,33) |
| InChIKey | PENAQRGWKXSLPK-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|