C26H32N2O6 — CID 110076714
4-butoxy-3-[5-(2,3-dimethoxyphenyl)-1-(2-hydroxybutyl)pyrazol-3-yl]benzoic acid (PubChem CID 110076714) has the molecular formula C26H32N2O6 and a molecular weight of 468.55 g/mol. Its IUPAC name is 4-butoxy-3-[5-(2,3-dimethoxyphenyl)-1-(2-hydroxybutyl)pyrazol-3-yl]benzoic acid.
| Compound Name | 4-butoxy-3-[5-(2,3-dimethoxyphenyl)-1-(2-hydroxybutyl)pyrazol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 110076714 |
| Molecular Formula | C26H32N2O6 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 4-butoxy-3-[5-(2,3-dimethoxyphenyl)-1-(2-hydroxybutyl)pyrazol-3-yl]benzoic acid |
| SMILES | CCCCOc1ccc(C(=O)O)cc1-c1cc(-c2cccc(OC)c2OC)n(CC(O)CC)n1 |
| InChI | InChI=1S/C26H32N2O6/c1-5-7-13-34-23-12-11-17(26(30)31)14-20(23)21-15-22(28(27-21)16-18(29)6-2)19-9-8-10-24(32-3)25(19)33-4/h8-12,14-15,18,29H,5-7,13,16H2,1-4H3,(H,30,31) |
| InChIKey | NXAGIEJGJKBOLR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|