C22H23FN2O4 — CID 124959672
4-ethoxy-3-[5-(3-fluorophenyl)-1-[(2S)-2-hydroxybutyl]pyrazol-3-yl]benzoic acid (PubChem CID 124959672) has the molecular formula C22H23FN2O4 and a molecular weight of 398.43 g/mol. Its IUPAC name is 4-ethoxy-3-[5-(3-fluorophenyl)-1-[(2S)-2-hydroxybutyl]pyrazol-3-yl]benzoic acid.
| Compound Name | 4-ethoxy-3-[5-(3-fluorophenyl)-1-[(2S)-2-hydroxybutyl]pyrazol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 124959672 |
| Molecular Formula | C22H23FN2O4 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 4-ethoxy-3-[5-(3-fluorophenyl)-1-[(2S)-2-hydroxybutyl]pyrazol-3-yl]benzoic acid |
| SMILES | CCOc1ccc(C(=O)O)cc1-c1cc(-c2cccc(F)c2)n(C[C@@H](O)CC)n1 |
| InChI | InChI=1S/C22H23FN2O4/c1-3-17(26)13-25-20(14-6-5-7-16(23)10-14)12-19(24-25)18-11-15(22(27)28)8-9-21(18)29-4-2/h5-12,17,26H,3-4,13H2,1-2H3,(H,27,28)/t17-/m0/s1 |
| InChIKey | GOXIXEZXBXLDRS-KRWDZBQOSA-N |
| XLogP | 4.22 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |