C20H19FN2O3 — CID 124953512
4-[5-(4-fluorophenyl)-1-[(2S)-2-hydroxybutyl]pyrazol-3-yl]benzoic acid (PubChem CID 124953512) has the molecular formula C20H19FN2O3 and a molecular weight of 354.38 g/mol. Its IUPAC name is 4-[5-(4-fluorophenyl)-1-[(2S)-2-hydroxybutyl]pyrazol-3-yl]benzoic acid.
| Compound Name | 4-[5-(4-fluorophenyl)-1-[(2S)-2-hydroxybutyl]pyrazol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 124953512 |
| Molecular Formula | C20H19FN2O3 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 4-[5-(4-fluorophenyl)-1-[(2S)-2-hydroxybutyl]pyrazol-3-yl]benzoic acid |
| SMILES | CC[C@H](O)Cn1nc(-c2ccc(C(=O)O)cc2)cc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H19FN2O3/c1-2-17(24)12-23-19(14-7-9-16(21)10-8-14)11-18(22-23)13-3-5-15(6-4-13)20(25)26/h3-11,17,24H,2,12H2,1H3,(H,25,26)/t17-/m0/s1 |
| InChIKey | DVTMNJOYVCSWCD-KRWDZBQOSA-N |
| XLogP | 3.83 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |