C21H21ClN2O4 — CID 124955370
3-[5-(4-chlorophenyl)-1-[(2R)-2-hydroxybutyl]pyrazol-3-yl]-4-methoxybenzoic acid (PubChem CID 124955370) has the molecular formula C21H21ClN2O4 and a molecular weight of 400.86 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)-1-[(2R)-2-hydroxybutyl]pyrazol-3-yl]-4-methoxybenzoic acid.
| Compound Name | 3-[5-(4-chlorophenyl)-1-[(2R)-2-hydroxybutyl]pyrazol-3-yl]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 124955370 |
| Molecular Formula | C21H21ClN2O4 |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 3-[5-(4-chlorophenyl)-1-[(2R)-2-hydroxybutyl]pyrazol-3-yl]-4-methoxybenzoic acid |
| SMILES | CC[C@@H](O)Cn1nc(-c2cc(C(=O)O)ccc2OC)cc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H21ClN2O4/c1-3-16(25)12-24-19(13-4-7-15(22)8-5-13)11-18(23-24)17-10-14(21(26)27)6-9-20(17)28-2/h4-11,16,25H,3,12H2,1-2H3,(H,26,27)/t16-/m1/s1 |
| InChIKey | FJHGJCRBVZPTMN-MRXNPFEDSA-N |
| XLogP | 4.35 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |