C27H26N2O3 — CID 110076737
3-(1-benzyl-5-phenylpyrazol-3-yl)-4-(2-methylpropoxy)benzoic acid (PubChem CID 110076737) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is 3-(1-benzyl-5-phenylpyrazol-3-yl)-4-(2-methylpropoxy)benzoic acid.
| Compound Name | 3-(1-benzyl-5-phenylpyrazol-3-yl)-4-(2-methylpropoxy)benzoic acid |
|---|---|
| PubChem CID | 110076737 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 3-(1-benzyl-5-phenylpyrazol-3-yl)-4-(2-methylpropoxy)benzoic acid |
| SMILES | CC(C)COc1ccc(C(=O)O)cc1-c1cc(-c2ccccc2)n(Cc2ccccc2)n1 |
| InChI | InChI=1S/C27H26N2O3/c1-19(2)18-32-26-14-13-22(27(30)31)15-23(26)24-16-25(21-11-7-4-8-12-21)29(28-24)17-20-9-5-3-6-10-20/h3-16,19H,17-18H2,1-2H3,(H,30,31) |
| InChIKey | APEOMELTTGGWMY-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |