C24H25N3O3S — CID 129459783
3-[(3R)-3-(6-methyl-4-phenyl-2-pyridinyl)piperidine-1-carbonyl]benzenesulfonamide (PubChem CID 129459783) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is 3-[(3R)-3-(6-methyl-4-phenyl-2-pyridinyl)piperidine-1-carbonyl]benzenesulfonamide.
| Compound Name | 3-[(3R)-3-(6-methyl-4-phenyl-2-pyridinyl)piperidine-1-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 129459783 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 3-[(3R)-3-(6-methyl-4-phenyl-2-pyridinyl)piperidine-1-carbonyl]benzenesulfonamide |
| SMILES | Cc1cc(-c2ccccc2)cc([C@@H]2CCCN(C(=O)c3cccc(S(N)(=O)=O)c3)C2)n1 |
| InChI | InChI=1S/C24H25N3O3S/c1-17-13-21(18-7-3-2-4-8-18)15-23(26-17)20-10-6-12-27(16-20)24(28)19-9-5-11-22(14-19)31(25,29)30/h2-5,7-9,11,13-15,20H,6,10,12,16H2,1H3,(H2,25,29,30)/t20-/m1/s1 |
| InChIKey | YTOQEPHMUZVPJQ-HXUWFJFHSA-N |
| XLogP | 3.72 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |