About ethyl (1S,3R,6R,7R)-4-azatricyclo[4.2.1.03,7]nonane-4-carboxylate
ethyl (1S,3R,6R,7R)-4-azatricyclo[4.2.1.03,7]nonane-4-carboxylate (PubChem CID 129460925) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is ethyl (1S,3R,6R,7R)-4-azatricyclo[4.2.1.03,7]nonane-4-carboxylate.
Analyze ethyl (1S,3R,6R,7R)-4-azatricyclo[4.2.1.03,7]nonane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (1S,3R,6R,7R)-4-azatricyclo[4.2.1.03,7]nonane-4-carboxylate?
The IUPAC name of ethyl (1S,3R,6R,7R)-4-azatricyclo[4.2.1.03,7]nonane-4-carboxylate (CID 129460925) is ethyl (1S,3R,6R,7R)-4-azatricyclo[4.2.1.03,7]nonane-4-carboxylate.
What is the SMILES notation for ethyl (1S,3R,6R,7R)-4-azatricyclo[4.2.1.03,7]nonane-4-carboxylate?
The canonical SMILES for ethyl (1S,3R,6R,7R)-4-azatricyclo[4.2.1.03,7]nonane-4-carboxylate is CCOC(=O)N1C[C@@H]2C[C@H]3C[C@H]2[C@H]1C3.
What is the InChIKey of ethyl (1S,3R,6R,7R)-4-azatricyclo[4.2.1.03,7]nonane-4-carboxylate?
The InChIKey is ZGQSOOZWONBRER-AXTSPUMRSA-N. The full InChI is InChI=1S/C11H17NO2/c1-2-14-11(13)12-6-8-3-7-4-9(8)10(12)5-7/h7-10H,2-6H2,1H3/t7-,8-,9+,10+/m0/s1.
What are the key properties of ethyl (1S,3R,6R,7R)-4-azatricyclo[4.2.1.03,7]nonane-4-carboxylate?
ethyl (1S,3R,6R,7R)-4-azatricyclo[4.2.1.03,7]nonane-4-carboxylate has a molecular weight of 195.26 g/mol, XLogP of 1.87, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (1S,3R,6R,7R)-4-azatricyclo[4.2.1.03,7]nonane-4-carboxylate is sourced from PubChem (CID 129460925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).