C11H21NO2 — CID 114597475
ethyl 2,3,5-trimethylpiperidine-1-carboxylate (PubChem CID 114597475) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is ethyl 2,3,5-trimethylpiperidine-1-carboxylate.
| Compound Name | ethyl 2,3,5-trimethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 114597475 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | ethyl 2,3,5-trimethylpiperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CC(C)CC(C)C1C |
| InChI | InChI=1S/C11H21NO2/c1-5-14-11(13)12-7-8(2)6-9(3)10(12)4/h8-10H,5-7H2,1-4H3 |
| InChIKey | BDRRZNIOUFMVHC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |