3-amino-4-oxo-4-(2,3,5-trimethylpiperidin-1-yl)butanoic acid

C12H22N2O3 — CID 114593012

IUPAC3-amino-4-oxo-4-(2,3,5-trimethylpiperidin-1-yl)butanoic acid
SMILESCC1CC(C)C(C)N(C(=O)C(N)CC(=O)O)C1
InChIInChI=1S/C12H22N2O3/c1-7-4-8(2)9(3)14(6-7)12(17)10(13)5-11(15)16/h7-10H,4-6,13H2,1-3H3,(H,15,16)
InChIKeyWEAVHALUIORIGH-UHFFFAOYSA-N
MW242.32 g/mol
LogP0.68
Rot. Bonds3

About 3-amino-4-oxo-4-(2,3,5-trimethylpiperidin-1-yl)butanoic acid

3-amino-4-oxo-4-(2,3,5-trimethylpiperidin-1-yl)butanoic acid (PubChem CID 114593012) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is 3-amino-4-oxo-4-(2,3,5-trimethylpiperidin-1-yl)butanoic acid.

Molecular Properties

Compound Name3-amino-4-oxo-4-(2,3,5-trimethylpiperidin-1-yl)butanoic acid
PubChem CID114593012
Molecular FormulaC12H22N2O3
Molecular Weight242.32 g/mol
Exact Mass242.16
IUPAC Name3-amino-4-oxo-4-(2,3,5-trimethylpiperidin-1-yl)butanoic acid
SMILESCC1CC(C)C(C)N(C(=O)C(N)CC(=O)O)C1
InChIInChI=1S/C12H22N2O3/c1-7-4-8(2)9(3)14(6-7)12(17)10(13)5-11(15)16/h7-10H,4-6,13H2,1-3H3,(H,15,16)
InChIKeyWEAVHALUIORIGH-UHFFFAOYSA-N
XLogP0.68
TPSA83.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.32
LogP ≤ 50.68
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-amino-4-oxo-4-(2,3,5-trimethylpiperidin-1-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-4-oxo-4-(2,3,5-trimethylpiperidin-1-yl)butanoic acid?
The IUPAC name of 3-amino-4-oxo-4-(2,3,5-trimethylpiperidin-1-yl)butanoic acid (CID 114593012) is 3-amino-4-oxo-4-(2,3,5-trimethylpiperidin-1-yl)butanoic acid.
What is the SMILES notation for 3-amino-4-oxo-4-(2,3,5-trimethylpiperidin-1-yl)butanoic acid?
The canonical SMILES for 3-amino-4-oxo-4-(2,3,5-trimethylpiperidin-1-yl)butanoic acid is CC1CC(C)C(C)N(C(=O)C(N)CC(=O)O)C1.
What is the InChIKey of 3-amino-4-oxo-4-(2,3,5-trimethylpiperidin-1-yl)butanoic acid?
The InChIKey is WEAVHALUIORIGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O3/c1-7-4-8(2)9(3)14(6-7)12(17)10(13)5-11(15)16/h7-10H,4-6,13H2,1-3H3,(H,15,16).
What are the key properties of 3-amino-4-oxo-4-(2,3,5-trimethylpiperidin-1-yl)butanoic acid?
3-amino-4-oxo-4-(2,3,5-trimethylpiperidin-1-yl)butanoic acid has a molecular weight of 242.32 g/mol, XLogP of 0.68, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-oxo-4-(2,3,5-trimethylpiperidin-1-yl)butanoic acid is sourced from PubChem (CID 114593012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).