About (2R)-2-amino-1-(2,3,5-trimethylpiperidin-1-yl)propan-1-one
(2R)-2-amino-1-(2,3,5-trimethylpiperidin-1-yl)propan-1-one (PubChem CID 104939664) has the molecular formula C11H22N2O
and a molecular weight of 198.31 g/mol. Its IUPAC name is (2R)-2-amino-1-(2,3,5-trimethylpiperidin-1-yl)propan-1-one.
Molecular Properties
| Compound Name | (2R)-2-amino-1-(2,3,5-trimethylpiperidin-1-yl)propan-1-one |
| PubChem CID | 104939664 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | (2R)-2-amino-1-(2,3,5-trimethylpiperidin-1-yl)propan-1-one |
| SMILES | CC1CC(C)C(C)N(C(=O)[C@@H](C)N)C1 |
| InChI | InChI=1S/C11H22N2O/c1-7-5-8(2)10(4)13(6-7)11(14)9(3)12/h7-10H,5-6,12H2,1-4H3/t7?,8?,9-,10?/m1/s1 |
| InChIKey | QJPCGNLYZDIXNI-OWTMBLHMSA-N |
| XLogP | 1.23 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-amino-1-(2,3,5-trimethylpiperidin-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-1-(2,3,5-trimethylpiperidin-1-yl)propan-1-one?
The IUPAC name of (2R)-2-amino-1-(2,3,5-trimethylpiperidin-1-yl)propan-1-one (CID 104939664) is (2R)-2-amino-1-(2,3,5-trimethylpiperidin-1-yl)propan-1-one.
What is the SMILES notation for (2R)-2-amino-1-(2,3,5-trimethylpiperidin-1-yl)propan-1-one?
The canonical SMILES for (2R)-2-amino-1-(2,3,5-trimethylpiperidin-1-yl)propan-1-one is CC1CC(C)C(C)N(C(=O)[C@@H](C)N)C1.
What is the InChIKey of (2R)-2-amino-1-(2,3,5-trimethylpiperidin-1-yl)propan-1-one?
The InChIKey is QJPCGNLYZDIXNI-OWTMBLHMSA-N. The full InChI is InChI=1S/C11H22N2O/c1-7-5-8(2)10(4)13(6-7)11(14)9(3)12/h7-10H,5-6,12H2,1-4H3/t7?,8?,9-,10?/m1/s1.
What are the key properties of (2R)-2-amino-1-(2,3,5-trimethylpiperidin-1-yl)propan-1-one?
(2R)-2-amino-1-(2,3,5-trimethylpiperidin-1-yl)propan-1-one has a molecular weight of 198.31 g/mol, XLogP of 1.23, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-1-(2,3,5-trimethylpiperidin-1-yl)propan-1-one is sourced from PubChem (CID 104939664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).