C12H23NO2 — CID 114597476
4-hydroxy-1-(2,3,5-trimethylpiperidin-1-yl)butan-1-one (PubChem CID 114597476) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 4-hydroxy-1-(2,3,5-trimethylpiperidin-1-yl)butan-1-one.
| Compound Name | 4-hydroxy-1-(2,3,5-trimethylpiperidin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 114597476 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 4-hydroxy-1-(2,3,5-trimethylpiperidin-1-yl)butan-1-one |
| SMILES | CC1CC(C)C(C)N(C(=O)CCCO)C1 |
| InChI | InChI=1S/C12H23NO2/c1-9-7-10(2)11(3)13(8-9)12(15)5-4-6-14/h9-11,14H,4-8H2,1-3H3 |
| InChIKey | FPFBBAGKOHUCPR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |