C15H23F3N4O — CID 129466192
(4R)-N-(pyrimidin-5-ylmethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]azepan-4-amine (PubChem CID 129466192) has the molecular formula C15H23F3N4O and a molecular weight of 332.37 g/mol. Its IUPAC name is (4R)-N-(pyrimidin-5-ylmethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]azepan-4-amine.
| Compound Name | (4R)-N-(pyrimidin-5-ylmethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]azepan-4-amine |
|---|---|
| PubChem CID | 129466192 |
| Molecular Formula | C15H23F3N4O |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | (4R)-N-(pyrimidin-5-ylmethyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]azepan-4-amine |
| SMILES | FC(F)(F)COCCN(Cc1cncnc1)[C@@H]1CCCNCC1 |
| InChI | InChI=1S/C15H23F3N4O/c16-15(17,18)11-23-7-6-22(10-13-8-20-12-21-9-13)14-2-1-4-19-5-3-14/h8-9,12,14,19H,1-7,10-11H2/t14-/m1/s1 |
| InChIKey | USWXPKWIWNIRSL-CQSZACIVSA-N |
| XLogP | 2.00 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|