C13H22F3N4O+ — CID 131985575
(S)-2-aminobutyl-(2-methoxyethyl)-methyl-[5-(trifluoromethyl)pyrimidin-2-yl]azanium (PubChem CID 131985575) has the molecular formula C13H22F3N4O+ and a molecular weight of 307.34 g/mol. Its IUPAC name is (S)-2-aminobutyl-(2-methoxyethyl)-methyl-[5-(trifluoromethyl)pyrimidin-2-yl]azanium.
| Compound Name | (S)-2-aminobutyl-(2-methoxyethyl)-methyl-[5-(trifluoromethyl)pyrimidin-2-yl]azanium |
|---|---|
| PubChem CID | 131985575 |
| Molecular Formula | C13H22F3N4O+ |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | (S)-2-aminobutyl-(2-methoxyethyl)-methyl-[5-(trifluoromethyl)pyrimidin-2-yl]azanium |
| SMILES | CCC(N)C[N@@+](C)(CCOC)c1ncc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C13H22F3N4O/c1-4-11(17)9-20(2,5-6-21-3)12-18-7-10(8-19-12)13(14,15)16/h7-8,11H,4-6,9,17H2,1-3H3/q+1/t11?,20-/m1/s1 |
| InChIKey | ZRUHQQNPSQVPEF-ZRYLAOAESA-N |
| XLogP | 1.82 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|