C16H27N5O — CID 95598765
(3S)-N-[(2-morpholin-4-ylpyrimidin-5-yl)methyl]-1-propan-2-ylpyrrolidin-3-amine (PubChem CID 95598765) has the molecular formula C16H27N5O and a molecular weight of 305.43 g/mol. Its IUPAC name is (3S)-N-[(2-morpholin-4-ylpyrimidin-5-yl)methyl]-1-propan-2-ylpyrrolidin-3-amine.
| Compound Name | (3S)-N-[(2-morpholin-4-ylpyrimidin-5-yl)methyl]-1-propan-2-ylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 95598765 |
| Molecular Formula | C16H27N5O |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | (3S)-N-[(2-morpholin-4-ylpyrimidin-5-yl)methyl]-1-propan-2-ylpyrrolidin-3-amine |
| SMILES | CC(C)N1CC[C@H](NCc2cnc(N3CCOCC3)nc2)C1 |
| InChI | InChI=1S/C16H27N5O/c1-13(2)21-4-3-15(12-21)17-9-14-10-18-16(19-11-14)20-5-7-22-8-6-20/h10-11,13,15,17H,3-9,12H2,1-2H3/t15-/m0/s1 |
| InChIKey | UVELYIHMRSHUMV-HNNXBMFYSA-N |
| XLogP | 0.89 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |