About (2S)-2-[[4-[(5-ethyl-1,3-oxazole-4-carbonyl)amino]benzoyl]amino]propanoic acid
(2S)-2-[[4-[(5-ethyl-1,3-oxazole-4-carbonyl)amino]benzoyl]amino]propanoic acid (PubChem CID 129468626) has the molecular formula C16H17N3O5
and a molecular weight of 331.33 g/mol. Its IUPAC name is (2S)-2-[[4-[(5-ethyl-1,3-oxazole-4-carbonyl)amino]benzoyl]amino]propanoic acid.
Molecular Properties
| Compound Name | (2S)-2-[[4-[(5-ethyl-1,3-oxazole-4-carbonyl)amino]benzoyl]amino]propanoic acid |
| PubChem CID | 129468626 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | (2S)-2-[[4-[(5-ethyl-1,3-oxazole-4-carbonyl)amino]benzoyl]amino]propanoic acid |
| SMILES | CCc1ocnc1C(=O)Nc1ccc(C(=O)N[C@@H](C)C(=O)O)cc1 |
| InChI | InChI=1S/C16H17N3O5/c1-3-12-13(17-8-24-12)15(21)19-11-6-4-10(5-7-11)14(20)18-9(2)16(22)23/h4-9H,3H2,1-2H3,(H,18,20)(H,19,21)(H,22,23)/t9-/m0/s1 |
| InChIKey | MQAAVSDGXHADIW-VIFPVBQESA-N |
| XLogP | 1.69 |
| TPSA | 121.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-[[4-[(5-ethyl-1,3-oxazole-4-carbonyl)amino]benzoyl]amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[[4-[(5-ethyl-1,3-oxazole-4-carbonyl)amino]benzoyl]amino]propanoic acid?
The IUPAC name of (2S)-2-[[4-[(5-ethyl-1,3-oxazole-4-carbonyl)amino]benzoyl]amino]propanoic acid (CID 129468626) is (2S)-2-[[4-[(5-ethyl-1,3-oxazole-4-carbonyl)amino]benzoyl]amino]propanoic acid.
What is the SMILES notation for (2S)-2-[[4-[(5-ethyl-1,3-oxazole-4-carbonyl)amino]benzoyl]amino]propanoic acid?
The canonical SMILES for (2S)-2-[[4-[(5-ethyl-1,3-oxazole-4-carbonyl)amino]benzoyl]amino]propanoic acid is CCc1ocnc1C(=O)Nc1ccc(C(=O)N[C@@H](C)C(=O)O)cc1.
What is the InChIKey of (2S)-2-[[4-[(5-ethyl-1,3-oxazole-4-carbonyl)amino]benzoyl]amino]propanoic acid?
The InChIKey is MQAAVSDGXHADIW-VIFPVBQESA-N. The full InChI is InChI=1S/C16H17N3O5/c1-3-12-13(17-8-24-12)15(21)19-11-6-4-10(5-7-11)14(20)18-9(2)16(22)23/h4-9H,3H2,1-2H3,(H,18,20)(H,19,21)(H,22,23)/t9-/m0/s1.
What are the key properties of (2S)-2-[[4-[(5-ethyl-1,3-oxazole-4-carbonyl)amino]benzoyl]amino]propanoic acid?
(2S)-2-[[4-[(5-ethyl-1,3-oxazole-4-carbonyl)amino]benzoyl]amino]propanoic acid has a molecular weight of 331.33 g/mol, XLogP of 1.69, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[[4-[(5-ethyl-1,3-oxazole-4-carbonyl)amino]benzoyl]amino]propanoic acid is sourced from PubChem (CID 129468626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).