C16H17NO4S — CID 129469228
(2R)-2-[benzyl-(4-methoxythiophene-2-carbonyl)amino]propanoic acid (PubChem CID 129469228) has the molecular formula C16H17NO4S and a molecular weight of 319.38 g/mol. Its IUPAC name is (2R)-2-[benzyl-(4-methoxythiophene-2-carbonyl)amino]propanoic acid.
| Compound Name | (2R)-2-[benzyl-(4-methoxythiophene-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 129469228 |
| Molecular Formula | C16H17NO4S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | (2R)-2-[benzyl-(4-methoxythiophene-2-carbonyl)amino]propanoic acid |
| SMILES | COc1csc(C(=O)N(Cc2ccccc2)[C@H](C)C(=O)O)c1 |
| InChI | InChI=1S/C16H17NO4S/c1-11(16(19)20)17(9-12-6-4-3-5-7-12)15(18)14-8-13(21-2)10-22-14/h3-8,10-11H,9H2,1-2H3,(H,19,20)/t11-/m1/s1 |
| InChIKey | YRJKSTCARFDZQM-LLVKDONJSA-N |
| XLogP | 2.87 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |