C10H15NO4S — CID 81122072
N,N-bis(2-hydroxyethyl)-4-methoxythiophene-2-carboxamide (PubChem CID 81122072) has the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-4-methoxythiophene-2-carboxamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-4-methoxythiophene-2-carboxamide |
|---|---|
| PubChem CID | 81122072 |
| Molecular Formula | C10H15NO4S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-4-methoxythiophene-2-carboxamide |
| SMILES | COc1csc(C(=O)N(CCO)CCO)c1 |
| InChI | InChI=1S/C10H15NO4S/c1-15-8-6-9(16-7-8)10(14)11(2-4-12)3-5-13/h6-7,12-13H,2-5H2,1H3 |
| InChIKey | TVZARJBIVZJBPE-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |