C13H21NO4 — CID 129469870
2-[(3R)-4-[(2R)-2,4-dimethylpent-4-enoyl]morpholin-3-yl]acetic acid (PubChem CID 129469870) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is 2-[(3R)-4-[(2R)-2,4-dimethylpent-4-enoyl]morpholin-3-yl]acetic acid.
| Compound Name | 2-[(3R)-4-[(2R)-2,4-dimethylpent-4-enoyl]morpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 129469870 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 2-[(3R)-4-[(2R)-2,4-dimethylpent-4-enoyl]morpholin-3-yl]acetic acid |
| SMILES | C=C(C)C[C@@H](C)C(=O)N1CCOC[C@H]1CC(=O)O |
| InChI | InChI=1S/C13H21NO4/c1-9(2)6-10(3)13(17)14-4-5-18-8-11(14)7-12(15)16/h10-11H,1,4-8H2,2-3H3,(H,15,16)/t10-,11-/m1/s1 |
| InChIKey | LNLAVUQKFTTZBZ-GHMZBOCLSA-N |
| XLogP | 1.29 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|