C17H21NO4 — CID 129469912
4-[2-[cyclopropyl-[[(3R)-oxolan-3-yl]methyl]amino]-2-oxoethyl]benzoic acid (PubChem CID 129469912) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is 4-[2-[cyclopropyl-[[(3R)-oxolan-3-yl]methyl]amino]-2-oxoethyl]benzoic acid.
| Compound Name | 4-[2-[cyclopropyl-[[(3R)-oxolan-3-yl]methyl]amino]-2-oxoethyl]benzoic acid |
|---|---|
| PubChem CID | 129469912 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 4-[2-[cyclopropyl-[[(3R)-oxolan-3-yl]methyl]amino]-2-oxoethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CC(=O)N(C[C@H]2CCOC2)C2CC2)cc1 |
| InChI | InChI=1S/C17H21NO4/c19-16(9-12-1-3-14(4-2-12)17(20)21)18(15-5-6-15)10-13-7-8-22-11-13/h1-4,13,15H,5-11H2,(H,20,21)/t13-/m1/s1 |
| InChIKey | DPSCXMDIKHLZNJ-CYBMUJFWSA-N |
| XLogP | 1.95 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |