C20H28N4 — CID 129472996
N-[(4-piperidin-1-ylphenyl)methyl]-1-[(6S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methanamine (PubChem CID 129472996) has the molecular formula C20H28N4 and a molecular weight of 324.47 g/mol. Its IUPAC name is N-[(4-piperidin-1-ylphenyl)methyl]-1-[(6S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methanamine.
| Compound Name | N-[(4-piperidin-1-ylphenyl)methyl]-1-[(6S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methanamine |
|---|---|
| PubChem CID | 129472996 |
| Molecular Formula | C20H28N4 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | N-[(4-piperidin-1-ylphenyl)methyl]-1-[(6S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methanamine |
| SMILES | c1cn2c(n1)CC[C@@H](CNCc1ccc(N3CCCCC3)cc1)C2 |
| InChI | InChI=1S/C20H28N4/c1-2-11-23(12-3-1)19-7-4-17(5-8-19)14-21-15-18-6-9-20-22-10-13-24(20)16-18/h4-5,7-8,10,13,18,21H,1-3,6,9,11-12,14-16H2/t18-/m0/s1 |
| InChIKey | CCVFKPNLXGSYJZ-SFHVURJKSA-N |
| XLogP | 3.23 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|