C22H27N3O4S — CID 1294751
N-[4-[[2-(2,3-dimethylphenoxy)acetyl]carbamothioylamino]-2-methoxyphenyl]-2-methylpropanamide (PubChem CID 1294751) has the molecular formula C22H27N3O4S and a molecular weight of 429.54 g/mol. Its IUPAC name is N-[4-[[2-(2,3-dimethylphenoxy)acetyl]carbamothioylamino]-2-methoxyphenyl]-2-methylpropanamide.
| Compound Name | N-[4-[[2-(2,3-dimethylphenoxy)acetyl]carbamothioylamino]-2-methoxyphenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 1294751 |
| Molecular Formula | C22H27N3O4S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | N-[4-[[2-(2,3-dimethylphenoxy)acetyl]carbamothioylamino]-2-methoxyphenyl]-2-methylpropanamide |
| SMILES | COc1cc(NC(=S)NC(=O)COc2cccc(C)c2C)ccc1NC(=O)C(C)C |
| InChI | InChI=1S/C22H27N3O4S/c1-13(2)21(27)24-17-10-9-16(11-19(17)28-5)23-22(30)25-20(26)12-29-18-8-6-7-14(3)15(18)4/h6-11,13H,12H2,1-5H3,(H,24,27)(H2,23,25,26,30) |
| InChIKey | JCFYXAOXHIQHGW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|