C20H24N2O5 — CID 6459943
3,4-dimethoxy-N-[3-methoxy-4-(2-methylpropanoylamino)phenyl]benzamide (PubChem CID 6459943) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[3-methoxy-4-(2-methylpropanoylamino)phenyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[3-methoxy-4-(2-methylpropanoylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 6459943 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 3,4-dimethoxy-N-[3-methoxy-4-(2-methylpropanoylamino)phenyl]benzamide |
| SMILES | COc1cc(NC(=O)c2ccc(OC)c(OC)c2)ccc1NC(=O)C(C)C |
| InChI | InChI=1S/C20H24N2O5/c1-12(2)19(23)22-15-8-7-14(11-17(15)26-4)21-20(24)13-6-9-16(25-3)18(10-13)27-5/h6-12H,1-5H3,(H,21,24)(H,22,23) |
| InChIKey | LBIBPDOOKDSBQL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |