C13H15Cl3N2O3 — CID 1298914
N-[2-methoxy-4-[(2,2,2-trichloroacetyl)amino]phenyl]-2-methylpropanamide (PubChem CID 1298914) has the molecular formula C13H15Cl3N2O3 and a molecular weight of 353.63 g/mol. Its IUPAC name is N-[2-methoxy-4-[(2,2,2-trichloroacetyl)amino]phenyl]-2-methylpropanamide.
| Compound Name | N-[2-methoxy-4-[(2,2,2-trichloroacetyl)amino]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 1298914 |
| Molecular Formula | C13H15Cl3N2O3 |
| Molecular Weight | 353.63 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | N-[2-methoxy-4-[(2,2,2-trichloroacetyl)amino]phenyl]-2-methylpropanamide |
| SMILES | COc1cc(NC(=O)C(Cl)(Cl)Cl)ccc1NC(=O)C(C)C |
| InChI | InChI=1S/C13H15Cl3N2O3/c1-7(2)11(19)18-9-5-4-8(6-10(9)21-3)17-12(20)13(14,15)16/h4-7H,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | SARDGEFVMOBULY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.63 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|