C10H10Cl3NO2 — CID 3499953
2,2,2-trichloro-N-(2-methoxy-4-methylphenyl)acetamide (PubChem CID 3499953) has the molecular formula C10H10Cl3NO2 and a molecular weight of 282.55 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(2-methoxy-4-methylphenyl)acetamide.
| Compound Name | 2,2,2-trichloro-N-(2-methoxy-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 3499953 |
| Molecular Formula | C10H10Cl3NO2 |
| Molecular Weight | 282.55 g/mol |
| Exact Mass | 280.98 |
| IUPAC Name | 2,2,2-trichloro-N-(2-methoxy-4-methylphenyl)acetamide |
| SMILES | COc1cc(C)ccc1NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H10Cl3NO2/c1-6-3-4-7(8(5-6)16-2)14-9(15)10(11,12)13/h3-5H,1-2H3,(H,14,15) |
| InChIKey | JIFSTOMKKJSRAU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.55 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|