C13H19F3N4O — CID 129480820
1-[(3R)-hex-5-en-3-yl]-3-[(1S)-2,2,2-trifluoro-1-(1-methylpyrazol-4-yl)ethyl]urea (PubChem CID 129480820) has the molecular formula C13H19F3N4O and a molecular weight of 304.32 g/mol. Its IUPAC name is 1-[(3R)-hex-5-en-3-yl]-3-[(1S)-2,2,2-trifluoro-1-(1-methylpyrazol-4-yl)ethyl]urea.
| Compound Name | 1-[(3R)-hex-5-en-3-yl]-3-[(1S)-2,2,2-trifluoro-1-(1-methylpyrazol-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 129480820 |
| Molecular Formula | C13H19F3N4O |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 1-[(3R)-hex-5-en-3-yl]-3-[(1S)-2,2,2-trifluoro-1-(1-methylpyrazol-4-yl)ethyl]urea |
| SMILES | C=CC[C@@H](CC)NC(=O)N[C@@H](c1cnn(C)c1)C(F)(F)F |
| InChI | InChI=1S/C13H19F3N4O/c1-4-6-10(5-2)18-12(21)19-11(13(14,15)16)9-7-17-20(3)8-9/h4,7-8,10-11H,1,5-6H2,2-3H3,(H2,18,19,21)/t10-,11+/m1/s1 |
| InChIKey | IANKKVNEMNUHME-MNOVXSKESA-N |
| XLogP | 2.68 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|