C14H21N3O — CID 129432308
1-[(3S)-hex-5-en-3-yl]-3-[(5-methyl-3-pyridinyl)methyl]urea (PubChem CID 129432308) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 1-[(3S)-hex-5-en-3-yl]-3-[(5-methyl-3-pyridinyl)methyl]urea.
| Compound Name | 1-[(3S)-hex-5-en-3-yl]-3-[(5-methyl-3-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 129432308 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 1-[(3S)-hex-5-en-3-yl]-3-[(5-methyl-3-pyridinyl)methyl]urea |
| SMILES | C=CC[C@H](CC)NC(=O)NCc1cncc(C)c1 |
| InChI | InChI=1S/C14H21N3O/c1-4-6-13(5-2)17-14(18)16-10-12-7-11(3)8-15-9-12/h4,7-9,13H,1,5-6,10H2,2-3H3,(H2,16,17,18)/t13-/m0/s1 |
| InChIKey | AQMFCGXDJVVZDZ-ZDUSSCGKSA-N |
| XLogP | 2.54 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|