C15H21FN6O — CID 129482545
(3R)-1-(6-ethyl-5-fluoropyrimidin-4-yl)-3-(1-propan-2-yltriazol-4-yl)pyrrolidin-3-ol (PubChem CID 129482545) has the molecular formula C15H21FN6O and a molecular weight of 320.37 g/mol. Its IUPAC name is (3R)-1-(6-ethyl-5-fluoropyrimidin-4-yl)-3-(1-propan-2-yltriazol-4-yl)pyrrolidin-3-ol.
| Compound Name | (3R)-1-(6-ethyl-5-fluoropyrimidin-4-yl)-3-(1-propan-2-yltriazol-4-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 129482545 |
| Molecular Formula | C15H21FN6O |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (3R)-1-(6-ethyl-5-fluoropyrimidin-4-yl)-3-(1-propan-2-yltriazol-4-yl)pyrrolidin-3-ol |
| SMILES | CCc1ncnc(N2CC[C@](O)(c3cn(C(C)C)nn3)C2)c1F |
| InChI | InChI=1S/C15H21FN6O/c1-4-11-13(16)14(18-9-17-11)21-6-5-15(23,8-21)12-7-22(10(2)3)20-19-12/h7,9-10,23H,4-6,8H2,1-3H3/t15-/m1/s1 |
| InChIKey | JNIJTHSNTDALHT-OAHLLOKOSA-N |
| XLogP | 1.45 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |