C17H24N4O2 — CID 129482810
(3S)-1-(2-phenoxyethyl)-3-(1-propan-2-yltriazol-4-yl)pyrrolidin-3-ol (PubChem CID 129482810) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is (3S)-1-(2-phenoxyethyl)-3-(1-propan-2-yltriazol-4-yl)pyrrolidin-3-ol.
| Compound Name | (3S)-1-(2-phenoxyethyl)-3-(1-propan-2-yltriazol-4-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 129482810 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | (3S)-1-(2-phenoxyethyl)-3-(1-propan-2-yltriazol-4-yl)pyrrolidin-3-ol |
| SMILES | CC(C)n1cc([C@]2(O)CCN(CCOc3ccccc3)C2)nn1 |
| InChI | InChI=1S/C17H24N4O2/c1-14(2)21-12-16(18-19-21)17(22)8-9-20(13-17)10-11-23-15-6-4-3-5-7-15/h3-7,12,14,22H,8-11,13H2,1-2H3/t17-/m0/s1 |
| InChIKey | DSHVSBRUOLBSNH-KRWDZBQOSA-N |
| XLogP | 1.83 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |