C14H23F3N4O2 — CID 128980388
3-(1-propan-2-yltriazol-4-yl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidin-3-ol (PubChem CID 128980388) has the molecular formula C14H23F3N4O2 and a molecular weight of 336.36 g/mol. Its IUPAC name is 3-(1-propan-2-yltriazol-4-yl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidin-3-ol.
| Compound Name | 3-(1-propan-2-yltriazol-4-yl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidin-3-ol |
|---|---|
| PubChem CID | 128980388 |
| Molecular Formula | C14H23F3N4O2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 3-(1-propan-2-yltriazol-4-yl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidin-3-ol |
| SMILES | CC(C)n1cc(C2(O)CCCN(CCOCC(F)(F)F)C2)nn1 |
| InChI | InChI=1S/C14H23F3N4O2/c1-11(2)21-8-12(18-19-21)13(22)4-3-5-20(9-13)6-7-23-10-14(15,16)17/h8,11,22H,3-7,9-10H2,1-2H3 |
| InChIKey | MKHOYBDJFXPCPW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|