C19H24N2O2 — CID 129482891
(3R,4S)-4-methyl-3-[(2R)-1-quinolin-2-ylpyrrolidin-2-yl]oxan-4-ol (PubChem CID 129482891) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is (3R,4S)-4-methyl-3-[(2R)-1-quinolin-2-ylpyrrolidin-2-yl]oxan-4-ol.
| Compound Name | (3R,4S)-4-methyl-3-[(2R)-1-quinolin-2-ylpyrrolidin-2-yl]oxan-4-ol |
|---|---|
| PubChem CID | 129482891 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (3R,4S)-4-methyl-3-[(2R)-1-quinolin-2-ylpyrrolidin-2-yl]oxan-4-ol |
| SMILES | C[C@]1(O)CCOC[C@H]1[C@H]1CCCN1c1ccc2ccccc2n1 |
| InChI | InChI=1S/C19H24N2O2/c1-19(22)10-12-23-13-15(19)17-7-4-11-21(17)18-9-8-14-5-2-3-6-16(14)20-18/h2-3,5-6,8-9,15,17,22H,4,7,10-13H2,1H3/t15-,17+,19-/m0/s1 |
| InChIKey | LFMMFKBUCLSWAF-WDYCEAGBSA-N |
| XLogP | 2.99 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |